Difference between revisions of "RXN-14394"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18263 == * left end position: ** 194 * transcription direction: ** POSITIVE * right end position: ** 2497 * centisome position: ** 6.192148...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 334.43 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13677]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346] |
| − | {{#set: | + | {{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}} |
| − | {{#set: | + | {{#set: molecular weight=334.43 }} |
| + | {{#set: consumed by=RXN-13677}} | ||
Revision as of 18:35, 18 March 2018
Contents
Metabolite CPD-14705
- smiles:
- CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
- inchi key:
- InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
- common name:
- 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
- molecular weight:
- 334.43
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[Cys-Gly] conjugate" cannot be used as a page name in this wiki.
