Difference between revisions of "Tiso gene 9915"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10326 == * left end position: ** 3279 * transcription direction: ** POSITIVE * right end position: ** 5635 * centisome position: ** 37.9777...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * inchi key: ** InChIKey=OTOIIPJY...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10326 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
−
* left end position:
+
* smiles:
−
** 3279
+
** CC(C)(CO)C(C([O-])=O)O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
−
* right end position:
+
* common name:
−
** 5635
+
** (R)-pantoate
−
* centisome position:
+
* molecular weight:
−
** 37.97776    
+
** 147.15    
 
* Synonym(s):
 
* Synonym(s):
 +
** pantoate
 +
** L-pantoate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[NADH-DEHYDROG-A-RXN]]
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
−
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6692]]
+
−
* [[PWY-3781]]
+
−
* [[PWY0-1334]]
+
−
* [[PWY0-1335]]
+
−
* [[PWY-5083]]
+
−
* [[PWY-4302]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3279}}
+
* CAS : 470-29-1
−
{{#set: transcription direction=POSITIVE}}
+
* DRUGBANK : DB01930
−
{{#set: right end position=5635}}
+
* PUBCHEM:
−
{{#set: centisome position=37.97776   }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
−
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-6692|PWY-3781|PWY0-1334|PWY0-1335|PWY-5083|PWY-4302}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
 +
* BIGG : pant__R
 +
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
 +
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
 +
{{#set: common name=(R)-pantoate}}
 +
{{#set: molecular weight=147.15   }}
 +
{{#set: common name=pantoate|L-pantoate}}
 +
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
 +
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}

Revision as of 18:36, 18 March 2018

Metabolite L-PANTOATE

  • smiles:
    • CC(C)(CO)C(C([O-])=O)O
  • inchi key:
    • InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
  • common name:
    • (R)-pantoate
  • molecular weight:
    • 147.15
  • Synonym(s):
    • pantoate
    • L-pantoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(CO)C(C([O-])=O)O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9915&oldid=25531"