Difference between revisions of "Tiso gene 12960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_19787 == * left end position: ** 2 * transcription direction: ** POSITIVE * right end position: ** 146 * centisome position: ** 9.82318300e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19787 == |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 146 |
− | * | + | * centisome position: |
− | ** | + | ** 9.82318300e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=146}} | |
− | + | {{#set: centisome position=9.82318300e-2}} | |
− | + | {{#set: reaction associated=RNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:36, 18 March 2018
Gene Tiso_gene_19787
- left end position:
- 2
- transcription direction:
- POSITIVE
- right end position:
- 146
- centisome position:
- 9.82318300e-2
- Synonym(s):
Reactions associated
- RNA-DIRECTED-DNA-POLYMERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation