Difference between revisions of "CPD1G-773"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] == * common name: ** perillate * Synonym(s): ** perillic acid ** perillyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == |
| + | * smiles: | ||
| + | ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** S-ribosyl-L-homocysteine |
| + | * molecular weight: | ||
| + | ** 267.296 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-Ribosylhomocysteine |
| − | ** | + | ** Ribose-5-S-homocysteine |
| − | ** | + | ** S-D-ribosyl-L-homocysteine |
| − | ** | + | ** ribose-5-S-homocysteine |
| + | ** S-ribosylhomocysteine | ||
| + | ** S-(5-deoxy-D-ribos-5-yl)-L-homocysteine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 37558-16-0 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245776 25245776] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17575 17575] | ||
| + | * BIGG : rhcys | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03539 C03539] | ||
| + | {{#set: smiles=C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N}} | ||
| + | {{#set: common name=S-ribosyl-L-homocysteine}} | ||
| + | {{#set: molecular weight=267.296 }} | ||
| + | {{#set: common name=S-Ribosylhomocysteine|Ribose-5-S-homocysteine|S-D-ribosyl-L-homocysteine|ribose-5-S-homocysteine|S-ribosylhomocysteine|S-(5-deoxy-D-ribos-5-yl)-L-homocysteine}} | ||
| + | {{#set: produced by=ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN}} | ||
Revision as of 18:37, 18 March 2018
Contents
Metabolite CPD-564
- smiles:
- C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)
- inchi key:
- InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N
- common name:
- S-ribosyl-L-homocysteine
- molecular weight:
- 267.296
- Synonym(s):
- S-Ribosylhomocysteine
- Ribose-5-S-homocysteine
- S-D-ribosyl-L-homocysteine
- ribose-5-S-homocysteine
- S-ribosylhomocysteine
- S-(5-deoxy-D-ribos-5-yl)-L-homocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
