Difference between revisions of "CPD-18"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * smiles: ** C(O)C(O)C1(C=CC(O)=C(O)C=1) * inchi key: ** InChIKey=MTVWF...") |
(Created page with "Category:Gene == Gene Tiso_gene_4555 == * left end position: ** 9204 * transcription direction: ** POSITIVE * right end position: ** 10473 * centisome position: ** 62.4804...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_4555 == |
| − | * | + | * left end position: |
| − | ** | + | ** 9204 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 10473 |
| − | * | + | * centisome position: |
| − | ** | + | ** 62.480484 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[RXN-13733]] | |
| − | * [[RXN- | + | ** in-silico_annotation |
| − | == | + | ***automated-name-match |
| + | == Pathways associated == | ||
| + | * [[PWY-7119]] | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=9204}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=10473}} | |
| − | + | {{#set: centisome position=62.480484 }} | |
| − | + | {{#set: reaction associated=RXN-13733}} | |
| − | + | {{#set: pathway associated=PWY-7119}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:37, 18 March 2018
Gene Tiso_gene_4555
- left end position:
- 9204
- transcription direction:
- POSITIVE
- right end position:
- 10473
- centisome position:
- 62.480484
- Synonym(s):
Reactions associated
- RXN-13733
- in-silico_annotation
- automated-name-match
- in-silico_annotation
