Difference between revisions of "Menaquinols"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-26 RXN66-26] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-26 RXN66-26] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1.0 [[NADH-P-OR-NOP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL]][c] '''+''' 1.0 [[OXYGEN-MOLECULE]][c] '''=>''' 1.0 [[NAD-P-OR-NOP]][c] '''+''' 2.0 [[WATER]][c] '''+''' 1.0 [[CPD-8646]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1.0 NAD(P)H[c] '''+''' 1.0 H+[c] '''+''' 1.0 5α-cholesta-7,24-dien-3β-ol[c] '''+''' 1.0 oxygen[c] '''=>''' 1.0 NAD(P)+[c] '''+''' 2.0 H2O[c] '''+''' 1.0 7-dehydrodesmosterol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_5446]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: gene associated=Tiso_gene_5446}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:37, 18 March 2018
Contents
Reaction RXN66-26
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NADH-P-OR-NOP[c] + 1.0 PROTON[c] + 1.0 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL[c] + 1.0 OXYGEN-MOLECULE[c] => 1.0 NAD-P-OR-NOP[c] + 2.0 WATER[c] + 1.0 CPD-8646[c]
- With common name(s):
- 1.0 NAD(P)H[c] + 1.0 H+[c] + 1.0 5α-cholesta-7,24-dien-3β-ol[c] + 1.0 oxygen[c] => 1.0 NAD(P)+[c] + 2.0 H2O[c] + 1.0 7-dehydrodesmosterol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus