Difference between revisions of "Tiso gene 15547"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_4171 == * left end position: ** 10170 * transcription direction: ** POSITIVE * right end position: ** 11971 * centisome position: ** 66.627...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4171 == |
− | * | + | * left end position: |
− | ** | + | ** 10170 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11971 |
− | * | + | * centisome position: |
− | ** | + | ** 66.62736 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***automated-name-match |
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-922]] | ||
+ | * [[PWY-7391]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10170}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11971}} | |
− | + | {{#set: centisome position=66.62736 }} | |
− | + | {{#set: reaction associated=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-922|PWY-7391}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:37, 18 March 2018
Gene Tiso_gene_4171
- left end position:
- 10170
- transcription direction:
- POSITIVE
- right end position:
- 11971
- centisome position:
- 66.62736
- Synonym(s):
Reactions associated
- DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN
- in-silico_annotation
- automated-name-match
- pantograph-athaliana
- pantograph-esiliculosus
- in-silico_annotation