Difference between revisions of "CPD0-2117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13677 RXN-13677] == * direction: ** LEFT-TO-RIGHT * common name: ** aminopeptidase_n ** membran...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13677 RXN-13677] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
+
 
* common name:
 
* common name:
−
** α-D-ribose 5-phosphate
+
** aminopeptidase_n
−
* molecular weight:
+
** membrane_aminopeptidase_i
−
** 228.095   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2]
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-ribofuranose 5-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[R5PDP]]
+
* With identifiers:
−
* [[RXN-14997]]
+
** 1 [[CPD-14705]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[CPD-14706]][c]
−
* [[RXN-15345]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 4-hydroxy-2-nonenal-[Cys-Gly] conjugate[c] '''+''' 1 H2O[c] '''=>''' 1 glycine[c] '''+''' 1 4-hydroxy-2-nonenal-[L-Cys] conjugate[c]
−
* [[ARDP]]
+
 
−
* [[RIBOKIN-RXN]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RPDPK]]
+
* [[Tiso_gene_16906]]
−
* [[RXN-14456]]
+
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
* [[Tiso_gene_860]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7112]], 4-hydroxy-2-nonenal detoxification: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7112 PWY-7112]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640]
+
{{#set: common name=aminopeptidase_n}}
−
* CHEBI:
+
{{#set: common name=membrane_aminopeptidase_i}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189]
+
{{#set: ec number=EC-3.4.11.2}}
−
* METABOLIGHTS : MTBLC18189
+
{{#set: gene associated=Tiso_gene_16906|Tiso_gene_860}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: in pathway=PWY-7112}}
−
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=α-D-ribose 5-phosphate}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: molecular weight=228.095    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=α-D-ribofuranose 5-phosphate}}
+
−
{{#set: consumed by=R5PDP|RXN-14997|RXN-15345}}
+
−
{{#set: produced by=ARDP|RIBOKIN-RXN}}
+
−
{{#set: consumed or produced by=RPDPK|RXN-14456}}
+

Revision as of 18:38, 18 March 2018

Reaction RXN-13677

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aminopeptidase_n
    • membrane_aminopeptidase_i
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4-hydroxy-2-nonenal-[Cys-Gly] conjugate[c] + 1 H2O[c] => 1 glycine[c] + 1 4-hydroxy-2-nonenal-[L-Cys] conjugate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7112, 4-hydroxy-2-nonenal detoxification: PWY-7112
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-2117&oldid=25775"