Difference between revisions of "Holo-EntB"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-5-L-Arabinooligosaccharides 1-5-L-Arabinooligosaccharides] == * common name: ** a (1->5)-&alp...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-α-D-galacturonate |
| + | * molecular weight: | ||
| + | ** 577.265 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[UDPGALor]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244587 25244587] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57635 57635] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00617 C00617] | ||
| + | * HMDB : HMDB12302 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}} | ||
| + | {{#set: inchi key=InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K}} | ||
| + | {{#set: common name=UDP-α-D-galacturonate}} | ||
| + | {{#set: molecular weight=577.265 }} | ||
| + | {{#set: produced by=UDPGALor}} | ||
| + | {{#set: reversible reaction associated=UDP-GLUCURONATE-4-EPIMERASE-RXN}} | ||
Revision as of 18:38, 18 March 2018
Contents
Metabolite UDP-D-GALACTURONATE
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
- inchi key:
- InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K
- common name:
- UDP-α-D-galacturonate
- molecular weight:
- 577.265
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.
