Difference between revisions of "ALDH im4ac"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Tiso_gene_6741 == * left end position: ** 121 * transcription direction: ** POSITIVE * right end position: ** 1104 * centisome position: ** 1.01809...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_6741 == |
| − | * | + | * left end position: |
| − | ** | + | ** 121 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 1104 |
| − | * | + | * centisome position: |
| − | ** | + | ** 1.01809 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
| − | * [[ | + | ** in-silico_annotation |
| − | == | + | ***ec-number |
| − | + | == Pathways associated == | |
== External links == | == External links == | ||
| − | + | {{#set: left end position=121}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=1104}} | |
| − | + | {{#set: centisome position=1.01809 }} | |
| − | + | {{#set: reaction associated=RNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 18:38, 18 March 2018
Gene Tiso_gene_6741
- left end position:
- 121
- transcription direction:
- POSITIVE
- right end position:
- 1104
- centisome position:
- 1.01809
- Synonym(s):
Reactions associated
- RNA-DIRECTED-DNA-POLYMERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
