Difference between revisions of "1.11.1.12-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * inchi key: ** InChIKey=O...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-160 RXN1F-160] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-7α-hydroxykaur-16...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-160 RXN1F-160] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ent-7α-hydroxykaur-16-en-19-oate monooxygenase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-136]][c] '''=>''' 1 [[CPD1F-138]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 ent-7α-hydroxykaur-16-en-19-oate[c] '''=>''' 1 gibberellin A12-aldehyde[c] '''+''' 2 H2O[c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_3577]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_8263]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047] | ||
+ | ** '''6''' reactions found over '''15''' reactions in the full pathway | ||
+ | * [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22904 22904] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06295 R06295] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=ent-7α-hydroxykaur-16-en-19-oate monooxygenase}} |
− | + | {{#set: gene associated=Tiso_gene_3577|Tiso_gene_8263}} | |
− | + | {{#set: in pathway=PWY-5047|PWY-5034}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:39, 18 March 2018
Contents
Reaction RXN1F-160
- direction:
- LEFT-TO-RIGHT
- common name:
- ent-7α-hydroxykaur-16-en-19-oate monooxygenase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADPH[c] + 1 oxygen[c] + 1 H+[c] + 1 ent-7α-hydroxykaur-16-en-19-oate[c] => 1 gibberellin A12-aldehyde[c] + 2 H2O[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5047, gibberellin biosynthesis IV (Gibberella fujikuroi): PWY-5047
- 6 reactions found over 15 reactions in the full pathway
- PWY-5034, GA12 biosynthesis: PWY-5034
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links