Difference between revisions of "ATID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
(Created page with "Category:Gene == Gene Tiso_gene_16719 == * left end position: ** 72 * transcription direction: ** NEGATIVE * right end position: ** 3225 * centisome position: ** 1.7282765...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
+
== Gene Tiso_gene_16719 ==
−
* smiles:
+
* left end position:
−
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
+
** 72
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** nicotine-1'-N-oxide
+
** 3225
−
* molecular weight:
+
* centisome position:
−
** 178.233    
+
** 1.7282765    
 
* Synonym(s):
 
* Synonym(s):
−
** nicotine N'-oxide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[1.2.1.31-RXN]]
−
* [[RXN66-81]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[ALLYSINE-DEHYDROG-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[ASPARTATE-RACEMASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-10855]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY66-425]]
 +
* [[LYSINE-DEG1-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=72}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=3225}}
−
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
+
{{#set: centisome position=1.7282765   }}
−
* HMDB : HMDB01497
+
{{#set: reaction associated=1.2.1.31-RXN|ALLYSINE-DEHYDROG-RXN|ASPARTATE-RACEMASE-RXN|RXN-10855}}
−
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
+
{{#set: pathway associated=PWY66-425|LYSINE-DEG1-PWY}}
−
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
+
−
{{#set: common name=nicotine-1'-N-oxide}}
+
−
{{#set: molecular weight=178.233   }}
+
−
{{#set: common name=nicotine N'-oxide}}
+
−
{{#set: produced by=RXN66-81}}
+

Revision as of 18:41, 18 March 2018

Gene Tiso_gene_16719

  • left end position:
    • 72
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3225
  • centisome position:
    • 1.7282765
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATID&oldid=26163"