Difference between revisions of "GALACTOSYLCERAMIDE-SULFATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == * smiles: ** C=CC2(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] == * direction: ** REVERSIBLE * common name: ** R146 * Synonym(s): == Reaction Form...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01220 R01220] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
+
** REVERSIBLE
 
* common name:
 
* common name:
−
** magnesium-protoporphyrin IX 13-monomethyl ester
+
** R146
−
* molecular weight:
+
−
** 597.975   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Mg-protoporphyrin monomethyl ester
 
−
** magnesium protoporphyrin monomethyl ester
 
−
** MgPMME
 
−
** magnesium-protoporphyrin IX 13-methyl ester
 
−
** MgP monomethyl ester
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5282]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NADP]][c] '''+''' 1.0 [[METHYLENE-THF]][c] '''<=>''' 1.0 [[5-10-METHENYL-THF]][c] '''+''' 1.0 [[NADPH]][c]
−
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 NADP+[c] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''<=>''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 NADPH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_432]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954]
+
{{#set: common name=R146}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_432}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536]
+
{{#set: reconstruction source=orthology-synechocystis}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=597.975    }}
+
−
{{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}}
+
−
{{#set: consumed by=RXN-5282}}
+
−
{{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+

Revision as of 19:41, 18 March 2018

Reaction R01220

  • direction:
    • REVERSIBLE
  • common name:
    • R146
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADP+[c] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] <=> 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] + 1.0 NADPH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GALACTOSYLCERAMIDE-SULFATE&oldid=26183"