Difference between revisions of "R95"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * inchi key: ** InChIKey=LQQCGEGR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == |
* smiles: | * smiles: | ||
| − | ** C(=O)([O-])OP([O-])( | + | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K |
* common name: | * common name: | ||
| − | ** | + | ** dIDP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 409.165 |
* Synonym(s): | * Synonym(s): | ||
| + | ** deoxyinosine diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14228]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286] |
| − | {{#set: smiles=C(=O)([O-])OP([O-])( | + | * BIGG : didp |
| − | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB03536 |
| − | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}} |
| + | {{#set: common name=dIDP}} | ||
| + | {{#set: molecular weight=409.165 }} | ||
| + | {{#set: common name=deoxyinosine diphosphate}} | ||
| + | {{#set: reversible reaction associated=RXN-14228}} | ||
Revision as of 18:42, 18 March 2018
Contents
Metabolite CPD0-2231
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
- common name:
- dIDP
- molecular weight:
- 409.165
- Synonym(s):
- deoxyinosine diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
