Difference between revisions of "SINAPALDEHYDE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18211 RXN-18211] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == * smiles: ** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J | ||
| + | * common name: | ||
| + | ** 3-oxooctanoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 903.684 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-14275]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | * [[RXN-14277]] |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05267 C05267] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62619 62619] |
| − | {{#set: | + | * BIGG : 3oocoa |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173417 46173417] | ||
| + | * HMDB : HMDB03941 | ||
| + | {{#set: smiles=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J}} | ||
| + | {{#set: common name=3-oxooctanoyl-CoA}} | ||
| + | {{#set: molecular weight=903.684 }} | ||
| + | {{#set: produced by=RXN-14275}} | ||
| + | {{#set: reversible reaction associated=RXN-14277}} | ||
Revision as of 18:42, 18 March 2018
Contents
Metabolite CPD0-2106
- smiles:
- CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J
- common name:
- 3-oxooctanoyl-CoA
- molecular weight:
- 903.684
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
