Difference between revisions of "RXN-7677"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * smiles: ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Tiso_gene_6094 == * Synonym(s): == Reactions associated == * RXN0-5398 ** pantograph-esiliculosus == Pathways associated == * PWY-6019...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6094 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN0-5398]] |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | == Pathways associated == | |
− | + | * [[PWY-6019]] | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN0-5398}} | |
− | + | {{#set: pathway associated=PWY-6019}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:42, 18 March 2018
Gene Tiso_gene_6094
- Synonym(s):