Difference between revisions of "Tiso gene 18145"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nitriles Nitriles] == * common name: ** a nitrile * Synonym(s): ** nitrile ** R-CN ** a nitrile...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == |
| + | * smiles: | ||
| + | ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** β-D-fructofuranose 1-phosphate |
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** β-D-fructofuranose-1-P |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8631]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[KETOHEXOKINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 15978-08-2 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216] |
| + | * BIGG : f1p | ||
| + | {{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}} | ||
| + | {{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}} | ||
| + | {{#set: common name=β-D-fructofuranose 1-phosphate}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=β-D-fructofuranose-1-P}} | ||
| + | {{#set: consumed by=RXN-8631}} | ||
| + | {{#set: produced by=KETOHEXOKINASE-RXN}} | ||
Revision as of 18:43, 18 March 2018
Contents
Metabolite FRU1P
- smiles:
- C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
- inchi key:
- InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
- common name:
- β-D-fructofuranose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- β-D-fructofuranose-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 15978-08-2
- PUBCHEM:
- BIGG : f1p
"C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)" cannot be used as a page name in this wiki.
