Difference between revisions of "Tiso gene 5939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12200 RXN-12200] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12200 RXN-12200] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
 +
* inchi key:
 +
** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
 
* common name:
 
* common name:
−
** ORF
+
** N5-methyl--tetrahydropteroyl tri-L-glutamate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
+
** 713.66   
 
* Synonym(s):
 
* Synonym(s):
 +
** N5-methyl--H4PteGlu3
 +
** 5-methyltetrahydropteroyl tri-L-glutamate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CTP]][c] '''+''' 2 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[CMP]][c] '''+''' 2 [[Pi]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[HOMOCYSMET-RXN]]
−
** 1 CTP[c] '''+''' 2 H2O[c] '''=>''' 2 H+[c] '''+''' 1 CMP[c] '''+''' 2 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12899]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_20236]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7185]], UTP and CTP dephosphorylation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7177]], UTP and CTP dephosphorylation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ORF}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302]
−
{{#set: ec number=EC-3.6.1.5}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
+
** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689]
−
{{#set: in pathway=PWY-7185|PWY-7177}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489]
−
{{#set: reconstruction category=manual}}
+
* HMDB : HMDB12177
−
{{#set: reconstruction source=primary_network}}
+
{{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: molecular weight=713.66    }}
 +
{{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}}
 +
{{#set: reversible reaction associated=HOMOCYSMET-RXN}}

Revision as of 18:43, 18 March 2018

Metabolite CPD-1302

  • smiles:
    • CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
  • inchi key:
    • InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
  • common name:
    • N5-methyl--tetrahydropteroyl tri-L-glutamate
  • molecular weight:
    • 713.66
  • Synonym(s):
    • N5-methyl--H4PteGlu3
    • 5-methyltetrahydropteroyl tri-L-glutamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5939&oldid=26360"