Difference between revisions of "GLYOHMETRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.1.99.4-RXN 4.1.99.4-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.1.99.4-RXN 4.1.99.4-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.99.7 EC-3.5.99.7] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[CPD-68]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[2-OXOBUTANOATE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 1-aminocyclopropane-1-carboxylate[c] '''+''' 1 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 2-oxobutanoate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_11198]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16933 16933] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00997 R00997] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9V2L2 Q9V2L2] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9WY68 Q9WY68] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P30297 P30297] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M523 Q7M523] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9URX3 Q9URX3] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-3.5.99.7}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_11198}} |
− | {{#set: | + | {{#set: in pathway=}} |
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-creinhardtii}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 19:43, 18 March 2018
Contents
Reaction 4.1.99.4-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-68[c] + 1 WATER[c] => 1 AMMONIUM[c] + 1 2-OXOBUTANOATE[c]
- With common name(s):
- 1 1-aminocyclopropane-1-carboxylate[c] + 1 H2O[c] => 1 ammonium[c] + 1 2-oxobutanoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
External links