Difference between revisions of "RXN-1121"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11840 RXN-11840] == * direction: ** LEFT-TO-RIGHT * common name: ** trna_pseudouridinesynthase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3)) |
+ | * inchi key: | ||
+ | ** InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** dTDP-β-L-rhamnose |
− | * | + | * molecular weight: |
− | + | ** 546.317 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** dTDP-6-deoxy-β-L-mannose | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DTDPDEHYRHAMREDUCT-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 572-96-3 | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245982 25245982] | |
− | {{#set: | + | * HMDB : HMDB06354 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03319 C03319] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57510 57510] |
− | {{#set: | + | * BIGG : dtdprmn |
+ | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))}} | ||
+ | {{#set: inchi key=InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L}} | ||
+ | {{#set: common name=dTDP-β-L-rhamnose}} | ||
+ | {{#set: molecular weight=546.317 }} | ||
+ | {{#set: common name=dTDP-6-deoxy-β-L-mannose}} | ||
+ | {{#set: produced by=DTDPDEHYRHAMREDUCT-RXN}} |
Revision as of 18:43, 18 March 2018
Contents
Metabolite DTDP-RHAMNOSE
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
- inchi key:
- InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
- common name:
- dTDP-β-L-rhamnose
- molecular weight:
- 546.317
- Synonym(s):
- dTDP-6-deoxy-β-L-mannose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.