Difference between revisions of "Tiso gene 15128"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18032 RXN-18032] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18032 RXN-18032] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J
 +
* common name:
 +
** (2E,5Z)-dodecenoyl-CoA
 +
* molecular weight:
 +
** 941.776   
 
* Synonym(s):
 
* Synonym(s):
 +
** 12:2-Δ2,Δ5-CoA
 +
** 2-trans,5-cis-dodecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17797]]
** 1 [[HCO3]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[CO3]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17796]]
** 1 hydrogencarbonate[c] '''<=>''' 1 H+[c] '''+''' 1 carbonate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=(2E,5Z)-dodecenoyl-CoA}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=941.776    }}
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=12:2-&Delta;2,&Delta;5-CoA|2-trans,5-cis-dodecenoyl-CoA}}
 +
{{#set: consumed by=RXN-17797}}
 +
{{#set: produced by=RXN-17796}}

Revision as of 18:43, 18 March 2018

Metabolite CPD-19150

  • smiles:
    • CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J
  • common name:
    • (2E,5Z)-dodecenoyl-CoA
  • molecular weight:
    • 941.776
  • Synonym(s):
    • 12:2-Δ2,Δ5-CoA
    • 2-trans,5-cis-dodecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.