Difference between revisions of "CPD-17637"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * smiles: ** CCCCCC(O)CCCCCC([O-])=O * inchi key: ** InChIKey=BNWKMHUFF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC(O)CCCCCC([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M |
+ | * common name: | ||
+ | ** 7-hydroxylaurate | ||
+ | * molecular weight: | ||
+ | ** 215.312 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-hydroxydodecanoic acid | ||
+ | ** 7-hydroxylauric acid | ||
+ | ** 7-hydroxydodecanoate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12184]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659904 90659904] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921] |
− | {{#set: | + | {{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: common name=7-hydroxylaurate}} |
+ | {{#set: molecular weight=215.312 }} | ||
+ | {{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}} | ||
+ | {{#set: consumed by=RXN-12184}} |
Revision as of 18:43, 18 March 2018
Contents
Metabolite CPD-17637
- smiles:
- CCCCCC(O)CCCCCC([O-])=O
- inchi key:
- InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
- common name:
- 7-hydroxylaurate
- molecular weight:
- 215.312
- Synonym(s):
- 7-hydroxydodecanoic acid
- 7-hydroxylauric acid
- 7-hydroxydodecanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)CCCCCC([O-])=O" cannot be used as a page name in this wiki.