Difference between revisions of "HOMO-CIT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCMf ATCMf] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:CMP phosphotransferase * Synony...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCMf ATCMf] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O
 +
* inchi key:
 +
** InChIKey=XKJVEVRQMLKSMO-SSDOTTSWSA-K
 
* common name:
 
* common name:
−
** ATP:CMP phosphotransferase
+
** (2R)-homocitrate
 +
* molecular weight:
 +
** 203.128   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxybutane-1,2,4-tricarboxylate
 +
** homocitric acid
 +
** 3-hydroxy-3-carboxyadipic acid
 +
** (2R)-2-hydroxybutane-1,2,4-tricarboxylate
 +
** (R)-2-hydroxybutane-1,2,4-tricarboxylate
 +
** homocitrate
 +
** (R)-homocitrate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CMP]][f] '''+''' 1.0 [[ATP]][f] '''=>''' 1.0 [[CDP]][f] '''+''' 1.0 [[ADP]][f]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-13722]]
−
** 1.0 CMP[f] '''+''' 1.0 ATP[f] '''=>''' 1.0 CDP[f] '''+''' 1.0 ADP[f]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9739]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 3562-74-1
−
{{#set: common name=ATP:CMP phosphotransferase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_9739}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849228 20849228]
−
{{#set: in pathway=}}
+
* HMDB : HMDB03518
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01251 C01251]
−
{{#set: reconstruction source=creinhardtii}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20171681.html 20171681]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58884 58884]
 +
{{#set: smiles=C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O}}
 +
{{#set: inchi key=InChIKey=XKJVEVRQMLKSMO-SSDOTTSWSA-K}}
 +
{{#set: common name=(2R)-homocitrate}}
 +
{{#set: molecular weight=203.128    }}
 +
{{#set: common name=2-hydroxybutane-1,2,4-tricarboxylate|homocitric acid|3-hydroxy-3-carboxyadipic acid|(2R)-2-hydroxybutane-1,2,4-tricarboxylate|(R)-2-hydroxybutane-1,2,4-tricarboxylate|homocitrate|(R)-homocitrate}}
 +
{{#set: reversible reaction associated=RXN-13722}}

Revision as of 18:43, 18 March 2018

Metabolite HOMO-CIT

  • smiles:
    • C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O
  • inchi key:
    • InChIKey=XKJVEVRQMLKSMO-SSDOTTSWSA-K
  • common name:
    • (2R)-homocitrate
  • molecular weight:
    • 203.128
  • Synonym(s):
    • 2-hydroxybutane-1,2,4-tricarboxylate
    • homocitric acid
    • 3-hydroxy-3-carboxyadipic acid
    • (2R)-2-hydroxybutane-1,2,4-tricarboxylate
    • (R)-2-hydroxybutane-1,2,4-tricarboxylate
    • homocitrate
    • (R)-homocitrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMO-CIT&oldid=26423"