Difference between revisions of "H2Otx"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_8283 == * Synonym(s): == Reactions associated == * PEPTIDYLPROLYL-ISOMERASE-RXN ** pantograph-esiliculosus == Pathways associa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8283 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 18:44, 18 March 2018
Gene Tiso_gene_8283
- Synonym(s):