Difference between revisions of "Tiso gene 19791"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14276 RXN-14276] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14276 RXN-14276] ==
−
* smiles:
+
* direction:
−
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
+
** [http://enzyme.expasy.org/EC/4.2.1.119 EC-4.2.1.119]
−
* common name:
+
−
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
−
* molecular weight:
+
−
** 221.167   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
 
−
** 4-methyl-5-(2-phosphoethyl)-thiazole
 
−
** THZ-P
 
−
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 
−
** HET-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[THI-P-SYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD0-2108]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-14916]][c]
−
* [[THIAZOLSYN3-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 trans-oct-2-enoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 (R)-3-hydroxyoctanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14262]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_6885]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_16145]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6920]], 6-gingerol analog biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6920 PWY-6920]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
+
{{#set: ec number=EC-4.2.1.119}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14262|Tiso_gene_6885|Tiso_gene_16145}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
+
{{#set: in pathway=PWY-6920}}
−
* BIGG : 4mpetz
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
+
−
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
+
−
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
−
{{#set: molecular weight=221.167    }}
+
−
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
+
−
{{#set: consumed by=THI-P-SYN-RXN}}
+
−
{{#set: produced by=THIAZOLSYN3-RXN}}
+

Revision as of 19:44, 18 March 2018

Reaction RXN-14276

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 trans-oct-2-enoyl-CoA[c] + 1 H2O[c] => 1 (R)-3-hydroxyoctanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6920, 6-gingerol analog biosynthesis (engineered): PWY-6920
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19791&oldid=26469"