Difference between revisions of "Tiso gene 2224"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-560 CPD-560] == * smiles: ** CSCC1(OC(C(C1O)O)O) * inchi key: ** InChIKey=OLVVOVIFTBSBBH-JD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C(=O)[O-])C(O)C([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L |
* common name: | * common name: | ||
− | ** | + | ** (2R,3S)-3-methylmalate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 146.099 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-erythro-3-methylmalate |
− | ** | + | ** erythro-β-methyl-D-malate |
− | ** | + | ** β-erythro-methylmalate |
− | ** | + | ** β-methyl-D-malate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7745]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}} |
− | {{#set: molecular weight= | + | {{#set: common name=(2R,3S)-3-methylmalate}} |
− | {{#set: common name= | + | {{#set: molecular weight=146.099 }} |
− | {{#set: consumed by= | + | {{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}} |
− | + | {{#set: consumed by=RXN-7745}} |
Revision as of 19:44, 18 March 2018
Contents
Metabolite CPD-7066
- smiles:
- CC(C(=O)[O-])C(O)C([O-])=O
- inchi key:
- InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
- common name:
- (2R,3S)-3-methylmalate
- molecular weight:
- 146.099
- Synonym(s):
- D-erythro-3-methylmalate
- erythro-β-methyl-D-malate
- β-erythro-methylmalate
- β-methyl-D-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)[O-])C(O)C([O-])=O" cannot be used as a page name in this wiki.