Difference between revisions of "Tiso gene 6495"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] == * smiles: ** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)...")
(Created page with "Category:Gene == Gene Tiso_gene_11797 == * left end position: ** 758 * transcription direction: ** POSITIVE * right end position: ** 2696 * centisome position: ** 10.08246...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] ==
+
== Gene Tiso_gene_11797 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)
+
** 758
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N5-carboxyaminoimidazole ribonucleotide
+
** 2696
−
* molecular weight:
+
* centisome position:
−
** 336.174    
+
** 10.082468    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
 
−
** 5-phosphoribosyl-5-carboxyaminoimidazole
 
−
** N5-CAIR
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.22.4-RXN]]
−
* [[RXN0-742]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=758}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15667 C15667]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2696}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58730 58730]
+
{{#set: centisome position=10.082468   }}
−
* BIGG : 5caiz
+
{{#set: reaction associated=3.1.22.4-RXN}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202011 25202011]
+
−
* HMDB : HMDB12268
+
−
{{#set: smiles=C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)}}
+
−
{{#set: inchi key=InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K}}
+
−
{{#set: common name=N5-carboxyaminoimidazole ribonucleotide}}
+
−
{{#set: molecular weight=336.174   }}
+
−
{{#set: common name=5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole|5-phosphoribosyl-5-carboxyaminoimidazole|N5-CAIR}}
+
−
{{#set: produced by=RXN0-742}}
+

Revision as of 18:44, 18 March 2018

Gene Tiso_gene_11797

  • left end position:
    • 758
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2696
  • centisome position:
    • 10.082468
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6495&oldid=26523"