Difference between revisions of "LEU-tRNAs"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9670 == * left end position: ** 4814 * transcription direction: ** POSITIVE * right end position: ** 6009 * centisome position: ** 42.29485...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N |
− | * | + | * common name: |
− | ** | + | ** melibiose |
− | * | + | * molecular weight: |
− | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-O-(α-D-galactopyranosyl)-D-glucopyranose | ||
+ | ** D-Gal-α(1->6)-D-glucose | ||
+ | ** D-melibiose | ||
+ | ** 6-O-α-D-galactopyranosyl-D-glucose | ||
+ | ** 6-(α-D-galactosido)-D-glucose | ||
+ | ** α-D-Galp-(1->6)-D-Glc | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ALPHAGALACTOSID-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RFH]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 585-99-9 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11458 11458] |
− | {{#set: | + | * HMDB : HMDB00048 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05402 C05402] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10974.html 10974] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61827 61827] | ||
+ | * BIGG : melib | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O}} | ||
+ | {{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N}} | ||
+ | {{#set: common name=melibiose}} | ||
+ | {{#set: molecular weight=342.299 }} | ||
+ | {{#set: common name=6-O-(α-D-galactopyranosyl)-D-glucopyranose|D-Gal-α(1->6)-D-glucose|D-melibiose|6-O-α-D-galactopyranosyl-D-glucose|6-(α-D-galactosido)-D-glucose|α-D-Galp-(1->6)-D-Glc}} | ||
+ | {{#set: consumed by=ALPHAGALACTOSID-RXN}} | ||
+ | {{#set: produced by=RFH}} |
Revision as of 18:45, 18 March 2018
Contents
Metabolite MELIBIOSE
- smiles:
- C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O
- inchi key:
- InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
- common name:
- melibiose
- molecular weight:
- 342.299
- Synonym(s):
- 6-O-(α-D-galactopyranosyl)-D-glucopyranose
- D-Gal-α(1->6)-D-glucose
- D-melibiose
- 6-O-α-D-galactopyranosyl-D-glucose
- 6-(α-D-galactosido)-D-glucose
- α-D-Galp-(1->6)-D-Glc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 585-99-9
- PUBCHEM:
- HMDB : HMDB00048
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : melib
- "D-Gal-α(1->6)-D-glucose" cannot be used as a page name in this wiki.
- "α-D-Galp-(1->6)-D-Glc" cannot be used as a page name in this wiki.