Difference between revisions of "FORMYLTHFGLUSYNTH-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_5865 == * left end position: ** 7412 * transcription direction: ** NEGATIVE * right end position: ** 12818 * centisome position: ** 57.7078...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5865 == |
− | * | + | * left end position: |
− | ** | + | ** 7412 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 12818 |
− | * | + | * centisome position: |
− | ** | + | ** 57.707882 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[FGAMSYN-RXN]] |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***ec-number |
− | == | + | ** experimental_annotation |
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6121]] | ||
+ | * [[PWY-6122]] | ||
+ | * [[PWY-6277]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7412}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=12818}} | |
− | + | {{#set: centisome position=57.707882 }} | |
− | + | {{#set: reaction associated=FGAMSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6121|PWY-6122|PWY-6277}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 19:45, 18 March 2018
Gene Tiso_gene_5865
- left end position:
- 7412
- transcription direction:
- NEGATIVE
- right end position:
- 12818
- centisome position:
- 57.707882
- Synonym(s):
Reactions associated
- FGAMSYN-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-athaliana
- in-silico_annotation