Difference between revisions of "Tiso gene 2848"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] == * smiles: ** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
(Created page with "Category:Gene == Gene Tiso_gene_2448 == * left end position: ** 4639 * transcription direction: ** POSITIVE * right end position: ** 6403 * centisome position: ** 23.90621...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] ==
+
== Gene Tiso_gene_2448 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4639
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-trans-nonenoyl-CoA
+
** 6403
−
* molecular weight:
+
* centisome position:
−
** 901.711    
+
** 23.90621    
 
* Synonym(s):
 
* Synonym(s):
−
** 2E-nonenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ATPASE-RXN]]
−
* [[RXN-14793]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12195]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12196]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-5462]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4639}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193739 72193739]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6403}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76292 76292]
+
{{#set: centisome position=23.90621   }}
−
{{#set: smiles=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: inchi key=InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: common name=2-trans-nonenoyl-CoA}}
+
−
{{#set: molecular weight=901.711   }}
+
−
{{#set: common name=2E-nonenoyl-CoA}}
+
−
{{#set: produced by=RXN-14793}}
+

Revision as of 18:45, 18 March 2018

Gene Tiso_gene_2448

  • left end position:
    • 4639
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6403
  • centisome position:
    • 23.90621
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2848&oldid=26636"