Difference between revisions of "RXN-16001"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2810 == * left end position: ** 2702 * transcription direction: ** NEGATIVE * right end position: ** 5264 * centisome position: ** 14.69356...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 5-hydroxy-CTP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 495.126 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 5-hydroxycytidine triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN0-7080]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584] |
| − | {{#set: | + | {{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}} |
| − | {{#set: | + | {{#set: common name=5-hydroxy-CTP}} |
| − | {{#set: | + | {{#set: molecular weight=495.126 }} |
| + | {{#set: common name=5-hydroxycytidine triphosphate}} | ||
| + | {{#set: produced by=RXN0-7080}} | ||
Revision as of 18:45, 18 March 2018
Contents
Metabolite 5-HYDROXY-CTP
- smiles:
- C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
- inchi key:
- InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
- common name:
- 5-hydroxy-CTP
- molecular weight:
- 495.126
- Synonym(s):
- 5-hydroxycytidine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
