Difference between revisions of "Tiso gene 19647"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Tiso_gene_16200 == * Synonym(s): == Reactions associated == * 1.14.11.18-RXN ** pantograph-esiliculosus * RXN66-470 ** [[pantograph]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16200 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[1.14.11.18-RXN]] | |
− | * [[RXN | + | ** [[pantograph]]-[[esiliculosus]] |
− | * | + | * [[RXN66-470]] |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | == Pathways associated == | |
− | + | * [[PWY66-387]] | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.14.11.18-RXN|RXN66-470}} | |
− | + | {{#set: pathway associated=PWY66-387}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 18:46, 18 March 2018
Gene Tiso_gene_16200
- Synonym(s):