Difference between revisions of "Tiso gene 6497"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACP ACP] == * common name: ** a holo-[acyl-carrier protein] * Synonym(s): ** a holo-ACP ** a ho...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACP ACP] ==
−
* smiles:
+
−
** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C
+
−
* inchi key:
+
−
** InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K
+
 
* common name:
 
* common name:
−
** di-trans,octa-cis-undecaprenyl diphosphate
+
** a holo-[acyl-carrier protein]
−
* molecular weight:
+
−
** 924.251   
+
 
* Synonym(s):
 
* Synonym(s):
−
** di-trans-poly-cis-undecaprenyl diphosphate
+
** a holo-ACP
−
** undecaprenyl-PP (ambiguous)
+
** a holo-[acp]
−
** bactoprenyl pyrophosphate
+
−
** undecaprenyl pyrophosphate (ambiguous)
+
−
** UPP (ambiguous)
+
−
** di-trans,octa-cis-undecaprenyl diphosphate
+
−
** C55-PP
+
−
** Und-PP
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8999]]
+
* [[RXN-11474]]
−
* [[RXN-11351]]
+
* [[RXN-17013]]
−
* [[RXN-11065]]
+
* [[RXN-17012]]
 +
* [[RXN-17015]]
 +
* [[RXN-16615]]
 +
* [[RXN1G-324]]
 +
* [[RXN0-6705]]
 +
* [[RXN1G-306]]
 +
* [[RXN-11479]]
 +
* [[RXN1G-138]]
 +
* [[RXN3O-5304]]
 +
* [[RXN1G-132]]
 +
* [[RXN0-947]]
 +
* [[RXN-16025]]
 +
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[RXN-17014]]
 +
* [[RXN-8391]]
 +
* [[RXN-14972]]
 +
* [[RXN3O-1803]]
 +
* [[RXN-11484]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[2.3.1.179-RXN]]
 +
* [[RXN-9523]]
 +
* [[UDPNACETYLGLUCOSAMACYLTRANS-RXN]]
 +
* [[RXN-10654]]
 +
* [[RXN-17020]]
 +
* [[RXN-10658]]
 +
* [[RXN0-5514]]
 +
* [[RXN-17024]]
 +
* [[RXN-9549]]
 +
* [[RXN-16629]]
 +
* [[RXN1G-218]]
 +
* [[RXN-9527]]
 +
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 +
* [[RXN-16621]]
 +
* [[RXN-16067]]
 +
* [[RXN-16076]]
 +
* [[RXN-16077]]
 +
* [[RXN-16625]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[MYRISTOYLACYLTRAN-RXN]]
 +
* [[RXN-13037]]
 +
* [[RXN0-2141]]
 +
* [[RXN-17022]]
 +
* [[RXN3O-9780]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[3.1.2.14-RXN]]
 +
* [[RXN1G-1003]]
 +
* [[RXN-10727]]
 +
* [[RXN1G-236]]
 +
* [[RXN1G-26]]
 +
* [[RXN1G-840]]
 +
* [[RXN-9550]]
 +
* [[3.1.2.21-RXN]]
 +
* [[RXN-9539]]
 +
* [[RXN-9535]]
 +
* [[RXN-9516]]
 +
* [[RXN-9531]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.3.1.41-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a holo-[acyl-carrier protein]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245563 25245563]
+
{{#set: common name=a holo-ACP|a holo-[acp]}}
−
* CHEBI:
+
{{#set: consumed by=MALONYL-COA-ACP-TRANSACYL-RXN|RXN-17155}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58405 58405]
+
{{#set: produced by=RXN-11474|RXN-17013|RXN-17012|RXN-17015|RXN-16615|RXN1G-324|RXN0-6705|RXN1G-306|RXN-11479|RXN1G-138|RXN3O-5304|RXN1G-132|RXN0-947|RXN-16025|1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN|RXN-17014|RXN-8391|RXN-14972|RXN3O-1803|RXN-11484|3-OXOACYL-ACP-SYNTH-BASE-RXN|2.3.1.179-RXN|RXN-9523|UDPNACETYLGLUCOSAMACYLTRANS-RXN|RXN-10654|RXN-17020|RXN-10658|RXN0-5514|RXN-17024|RXN-9549|RXN-16629|RXN1G-218|RXN-9527|UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN|RXN-16621|RXN-16067|RXN-16076|RXN-16077|RXN-16625|HOLO-ACP-SYNTH-RXN|MYRISTOYLACYLTRAN-RXN|RXN-13037|RXN0-2141|RXN-17022|RXN3O-9780|3-OXOACYL-ACP-SYNTH-RXN|3.1.2.14-RXN|RXN1G-1003|RXN-10727|RXN1G-236|RXN1G-26|RXN1G-840|RXN-9550|3.1.2.21-RXN|RXN-9539|RXN-9535|RXN-9516|RXN-9531}}
−
* BIGG : udcpdp
+
{{#set: reversible reaction associated=2.3.1.41-RXN|ACP-S-ACETYLTRANSFER-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04574 C04574]
+
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C}}
+
−
{{#set: inchi key=InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K}}
+
−
{{#set: common name=di-trans,octa-cis-undecaprenyl diphosphate}}
+
−
{{#set: molecular weight=924.251    }}
+
−
{{#set: common name=di-trans-poly-cis-undecaprenyl diphosphate|undecaprenyl-PP (ambiguous)|bactoprenyl pyrophosphate|undecaprenyl pyrophosphate (ambiguous)|UPP (ambiguous)|di-trans,octa-cis-undecaprenyl diphosphate|C55-PP|Und-PP}}
+
−
{{#set: produced by=RXN-8999|RXN-11351|RXN-11065}}
+

Revision as of 18:46, 18 March 2018

Metabolite ACP

  • common name:
    • a holo-[acyl-carrier protein]
  • Synonym(s):
    • a holo-ACP
    • a holo-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a holo-[acyl-carrier protein" cannot be used as a page name in this wiki.
"a holo-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6497&oldid=26747"