Difference between revisions of "CPD-514"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D9-21-C40-2-ACPs cis-cis-D9-21-C40-2-ACPs] == * common name: ** a cis,cis-delta9,21-C40...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** D-hexose 6-phosphate |
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HEXOKINASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4459709 4459709] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3658466.html 3658466] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965] | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=D-hexose 6-phosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: reversible reaction associated=HEXOKINASE-RXN}} |
Revision as of 18:47, 18 March 2018
Contents
Metabolite D-HEXOSE-6-PHOSPHATE
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L
- common name:
- D-hexose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.