Difference between revisions of "Tiso gene 10221"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2119 == * left end position: ** 13529 * transcription direction: ** POSITIVE * right end position: ** 17414 * centisome position: ** 65.748...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == |
− | * | + | * smiles: |
− | ** | + | ** CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J |
− | * | + | * common name: |
− | ** | + | ** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol |
− | * | + | * molecular weight: |
− | ** | + | ** 597.259 |
* Synonym(s): | * Synonym(s): | ||
+ | ** CDP-ME-2P | ||
+ | ** CDP-methyl-D-erylthritol 2-phosphate | ||
+ | ** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate | ||
+ | ** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-302]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.7.1.148-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919] |
− | {{#set: | + | * BIGG : 2p4c2me |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436] | ||
+ | {{#set: smiles=CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}} | ||
+ | {{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}} | ||
+ | {{#set: molecular weight=597.259 }} | ||
+ | {{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}} | ||
+ | {{#set: consumed by=RXN0-302}} | ||
+ | {{#set: produced by=2.7.1.148-RXN}} |
Revision as of 18:47, 18 March 2018
Contents
Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET
- smiles:
- CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
- inchi key:
- InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
- common name:
- 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
- molecular weight:
- 597.259
- Synonym(s):
- CDP-ME-2P
- CDP-methyl-D-erylthritol 2-phosphate
- 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
- 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O" cannot be used as a page name in this wiki.