Difference between revisions of "RXN1G-1003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-18 RXN66-18] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-18 RXN66-18] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170]
+
** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
 +
* common name:
 +
** canavaninosuccinate
 +
* molecular weight:
 +
** 291.24   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-22]]
−
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-8613]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-8614]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10]]
−
** 1 NAD(P)+[c] '''+''' 1 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol[c] '''=>''' 1 CO2[c] '''+''' 1 NAD(P)H[c] '''+''' 1 4α-methyl-5α-cholesta-8-en-3-one[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_897]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
+
−
** '''8''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.1.1.170}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246]
−
{{#set: gene associated=Tiso_gene_897}}
+
* HMDB : HMDB12197
−
{{#set: in pathway=PWY66-3}}
+
{{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=canavaninosuccinate}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=291.24    }}
 +
{{#set: consumed by=RXN-22}}
 +
{{#set: produced by=RXN-10}}

Revision as of 18:47, 18 March 2018

Metabolite CANAVANINOSUCCINATE

  • smiles:
    • C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
  • inchi key:
    • InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
  • common name:
    • canavaninosuccinate
  • molecular weight:
    • 291.24
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-1003&oldid=26886"