Difference between revisions of "Charged-ALA-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6948 RXN0-6948] == * direction: ** LEFT-TO-RIGHT * common name: ** n-acetylglutamate_synthase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6948 RXN0-6948] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
 +
* inchi key:
 +
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
 
* common name:
 
* common name:
−
** n-acetylglutamate_synthase
+
** L-threonylcarbamoyladenylate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.1 EC-2.3.1.1]
+
** 490.322   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14570]]
−
** 1 [[ACETYL-COA]][c] '''+''' 1 [[MET]][c] '''=>''' 1 [[CPD0-2015]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 acetyl-CoA[c] '''+''' 1 L-methionine[c] '''=>''' 1 Nα-acetyl-L-methionine[c] '''+''' 1 H+[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5365]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=n-acetylglutamate_synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
−
{{#set: ec number=EC-2.3.1.1}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_5365}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
−
{{#set: in pathway=}}
+
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=L-threonylcarbamoyladenylate}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=490.322    }}
 +
{{#set: consumed by=RXN-14570}}

Revision as of 18:47, 18 March 2018

Metabolite CPD-15435

  • smiles:
    • CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
  • inchi key:
    • InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
  • common name:
    • L-threonylcarbamoyladenylate
  • molecular weight:
    • 490.322
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Charged-ALA-tRNAs&oldid=26892"