Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_12787 == * Synonym(s): == Reactions associated == * 3.4.22.15-RXN ** pantograph-esiliculosus == Pathways associated == == Exte...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
+
== Gene Tiso_gene_12787 ==
* smiles:
+
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
+
* common name:
+
** 2-trans, 4-cis-undecadienoyl-CoA
+
* molecular weight:
+
** 927.749   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 4Z-undecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.4.22.15-RXN]]
* [[RXN-14775]]
+
** [[pantograph]]-[[esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.4.22.15-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658228 90658228]
+
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J}}
+
{{#set: common name=2-trans, 4-cis-undecadienoyl-CoA}}
+
{{#set: molecular weight=927.749    }}
+
{{#set: common name=2E, 4Z-undecadienoyl-CoA}}
+
{{#set: produced by=RXN-14775}}
+

Revision as of 18:47, 18 March 2018

Gene Tiso_gene_12787

  • Synonym(s):

Reactions associated

Pathways associated

External links