Difference between revisions of "1.5.1.19-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] == * smiles: ** C(C(O)CC(=O)[O-])[N+](C)(C)C * inchi key: ** InChIKey=PHIQ...") |
(Created page with "Category:Gene == Gene Tiso_gene_10282 == * left end position: ** 3609 * transcription direction: ** POSITIVE * right end position: ** 8609 * centisome position: ** 41.6359...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10282 == |
− | * | + | * left end position: |
− | ** | + | ** 3609 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 8609 |
− | * | + | * centisome position: |
− | ** | + | ** 41.635902 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ATPASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12195]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12196]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN0-5462]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7210]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3609}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=8609}} | |
− | + | {{#set: centisome position=41.635902 }} | |
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:48, 18 March 2018
Gene Tiso_gene_10282
- left end position:
- 3609
- transcription direction:
- POSITIVE
- right end position:
- 8609
- centisome position:
- 41.635902
- Synonym(s):
Reactions associated
- ATPASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- NUCLEOSIDE-TRIPHOSPHATASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-12195
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-12196
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN0-5462
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation