Difference between revisions of "Tiso gene 136"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16192 == * left end position: ** 1188 * transcription direction: ** POSITIVE * right end position: ** 4522 * centisome position: ** 26.2715...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_16192 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] ==
−
* left end position:
+
* smiles:
−
** 1188
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L
−
* right end position:
+
* common name:
−
** 4522
+
** a peptidoglycan dimer (S. aureus)
−
* centisome position:
+
* molecular weight:
−
** 26.27156    
+
** 3391.761    
 
* Synonym(s):
 
* Synonym(s):
 +
** [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15684]]
+
* [[RXN-11065]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[THIOL-OXIDASE-RXN]]
+
−
** in-silico_annotation
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-7533]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1188}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659087 90659087]
−
{{#set: right end position=4522}}
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C}}
−
{{#set: centisome position=26.27156   }}
+
{{#set: inchi key=InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L}}
−
{{#set: reaction associated=RXN-15684|THIOL-OXIDASE-RXN}}
+
{{#set: common name=a peptidoglycan dimer (S. aureus)}}
−
{{#set: pathway associated=PWY-7533}}
+
{{#set: molecular weight=3391.761   }}
 +
{{#set: common name=[N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl}}
 +
{{#set: consumed by=RXN-11065}}

Revision as of 18:48, 18 March 2018

Metabolite CPD-12259

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C
  • inchi key:
    • InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L
  • common name:
    • a peptidoglycan dimer (S. aureus)
  • molecular weight:
    • 3391.761
  • Synonym(s):
    • [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C" cannot be used as a page name in this wiki.


"N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_136&oldid=27012"