Difference between revisions of "Tiso gene 3818"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8987 == * left end position: ** 8446 * transcription direction: ** POSITIVE * right end position: ** 9686 * centisome position: ** 86.91089...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I |
− | * | + | * common name: |
− | ** | + | ** 3-oxopimeloyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 918.632 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxopimelyl-CoA | ||
+ | ** 3-ketopimeloyl-CoA | ||
+ | ** 3-ketopimelyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8032]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350] |
− | {{#set: reaction associated= | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715] | ||
+ | * HMDB : HMDB12158 | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}} | ||
+ | {{#set: common name=3-oxopimeloyl-CoA}} | ||
+ | {{#set: molecular weight=918.632 }} | ||
+ | {{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}} | ||
+ | {{#set: reversible reaction associated=RXN-8032}} |
Revision as of 18:48, 18 March 2018
Contents
Metabolite 3-OXOPIMELOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
- common name:
- 3-oxopimeloyl-CoA
- molecular weight:
- 918.632
- Synonym(s):
- 3-oxopimelyl-CoA
- 3-ketopimeloyl-CoA
- 3-ketopimelyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.