Difference between revisions of "Tiso gene 15416"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_14183 == * Synonym(s): == Reactions associated == * 4-COUMARATE--COA-LIGASE-RXN ** pantograph-esiliculosus * 6.2.1.34-RXN...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14183 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[4-COUMARATE--COA-LIGASE-RXN]] | |
− | * [[RXN- | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | * [[6.2.1.34-RXN]] |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
+ | * [[RXN-10695]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-10919]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-1126]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-2001]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6920]] | ||
+ | * [[PWY-6435]] | ||
+ | * [[PWY1F-FLAVSYN]] | ||
+ | * [[PWY-7046]] | ||
+ | * [[PWY-361]] | ||
+ | * [[PWY-7397]] | ||
+ | * [[PWY-1121]] | ||
+ | * [[PWY-6673]] | ||
+ | * [[PWY-6320]] | ||
+ | * [[PWY-6343]] | ||
+ | * [[PWY-6457]] | ||
+ | * [[PWY-735]] | ||
+ | * [[PWY-7398]] | ||
+ | * [[PWY-5754]] | ||
+ | * [[PWY-5135]] | ||
+ | * [[PWY-6982]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=4-COUMARATE--COA-LIGASE-RXN|6.2.1.34-RXN|RXN-10695|RXN-10919|RXN-1126|RXN-2001}} | |
− | + | {{#set: pathway associated=PWY-6920|PWY-6435|PWY1F-FLAVSYN|PWY-7046|PWY-361|PWY-7397|PWY-1121|PWY-6673|PWY-6320|PWY-6343|PWY-6457|PWY-735|PWY-7398|PWY-5754|PWY-5135|PWY-6982}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 18:48, 18 March 2018
Gene Tiso_gene_14183
- Synonym(s):
Reactions associated
Pathways associated
- PWY-6920
- PWY-6435
- PWY1F-FLAVSYN
- PWY-7046
- PWY-361
- PWY-7397
- PWY-1121
- PWY-6673
- PWY-6320
- PWY-6343
- PWY-6457
- PWY-735
- PWY-7398
- PWY-5754
- PWY-5135
- PWY-6982