|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOLIPASE-A2-RXN PHOSPHOLIPASE-A2-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) |
| + | * inchi key: |
| + | ** InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F |
| * common name: | | * common name: |
− | ** ORF | + | ** D-myo-inositol (1,3,4,6)-tetrakisphosphate |
− | ** abhydrolase_domain-containing_protein_4-like
| + | * molecular weight: |
− | * ec number: | + | ** 492.013 |
− | ** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** Ins(1,3,4,6)P4 |
| + | ** inositol (1,3,4,6)-tetrakisphosphate |
| + | ** 1D-myo -inositol 1,3,4,6-tetrakisphosphate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers: | + | * [[2.7.1.140-RXN]] |
− | ** 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[2-Lysophosphatidylcholines]][c] '''+''' 1 [[Long-Chain-Fatty-Acids]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[2.7.1.133-RXN]] |
− | ** 1 a phosphatidylcholine[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 a 1-acyl-sn-glycero-3-phosphocholine[c] '''+''' 1 a long-chain fatty acid[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_15047]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_15046]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_12959]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_12960]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-6803]], phosphatidylcholine acyl editing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6803 PWY-6803]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[LIPASYN-PWY]], phospholipases: [http://metacyc.org/META/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA:
| + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15801 15801]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04477 C04477] |
− | * LIGAND-RXN: | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01313 R01313] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57660 57660] |
− | * UNIPROT: | + | * METABOLIGHTS : MTBLC57660 |
− | ** [http://www.uniprot.org/uniprot/P04362 P04362] | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/Q7M335 Q7M335]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201336 25201336] |
− | ** [http://www.uniprot.org/uniprot/P14424 P14424]
| + | * HMDB : HMDB01187 |
− | ** [http://www.uniprot.org/uniprot/P14418 P14418] | + | {{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} |
− | ** [http://www.uniprot.org/uniprot/P19000 P19000] | + | {{#set: inchi key=InChIKey=ZAWIXNGTTZTBKV-JMVOWJSSSA-F}} |
− | ** [http://www.uniprot.org/uniprot/Q7M3E5 Q7M3E5] | + | {{#set: common name=D-myo-inositol (1,3,4,6)-tetrakisphosphate}} |
− | ** [http://www.uniprot.org/uniprot/P14420 P14420]
| + | {{#set: molecular weight=492.013 }} |
− | ** [http://www.uniprot.org/uniprot/P20258 P20258]
| + | {{#set: common name=Ins(1,3,4,6)P4|inositol (1,3,4,6)-tetrakisphosphate|1D-myo -inositol 1,3,4,6-tetrakisphosphate}} |
− | ** [http://www.uniprot.org/uniprot/P14423 P14423] | + | {{#set: consumed by=2.7.1.140-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q7LZG4 Q7LZG4]
| + | {{#set: produced by=2.7.1.133-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P20250 P20250]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21790 P21790]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21789 P21789]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81480 P81480]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47712 P47712]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20476 P20476]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24644 P24644]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81478 P81478]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06859 P06859]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39877 P39877]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48076 P48076]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M442 Q7M442]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18997 P18997]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20259 P20259]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20251 P20251]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21791 P21791]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81479 P81479]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51972 P51972]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4I6 Q7M4I6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4I5 Q7M4I5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14421 P14421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20260 P20260]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20252 P20252]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21792 P21792]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZQ5 Q7LZQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20253 P20253]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20381 P20381]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZQ7 Q7LZQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20254 P20254]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20255 P20255]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92147 Q92147]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20256 P20256]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20257 P20257]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47711 P47711]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31482 P31482]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62023 P62023]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11407 P11407]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18999 P18999]
| + | |
− | ** [http://www.uniprot.org/uniprot/O42187 O42187]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98996 Q98996]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9NP80 Q9NP80]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14615 P14615]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25498 P25498]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3V4 Q7M3V4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M334 Q7M334]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1V0 Q7M1V0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24606 P24606]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04417 P04417]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00621 P00621]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00620 P00620]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00622 P00622]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00593 P00593]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06596 P06596]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00610 P00610]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16354 P16354]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00630 P00630]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00594 P00594]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04054 P04054]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14555 P14555]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00606 P00606]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00618 P00618]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17934 P17934]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00627 P00627]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00628 P00628]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00629 P00629]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00611 P00611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00612 P00612]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00613 P00613]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00602 P00602]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00599 P00599]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00603 P00603]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00600 P00600]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00604 P00604]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00601 P00601]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00598 P00598]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00609 P00609]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00608 P00608]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00614 P00614]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00616 P00616]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00592 P00592]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04416 P04416]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00595 P00595]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00623 P00623]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00624 P00624]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24027 P24027]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62022 P62022]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04055 P04055]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04056 P04056]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04057 P04057]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00625 P00625]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06860 P06860]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00626 P00626]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14422 P14422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07037 P07037]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10116 P10116]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08873 P08873]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08872 P08872]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14411 P14411]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15445 P15445]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20474 P20474]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24605 P24605]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22640 P22640]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24293 P24293]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24294 P24294]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34180 P34180]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80003 P80003]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31854 P31854]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43434 P43434]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7LZG3 Q7LZG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43318 P43318]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90W39 Q90W39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10754 Q10754]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10755 Q10755]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10756 Q10756]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: common name=abhydrolase_domain-containing_protein_4-like}}
| + | |
− | {{#set: ec number=EC-3.1.1.4}} | + | |
− | {{#set: gene associated=Tiso_gene_15047|Tiso_gene_15046|Tiso_gene_12959|Tiso_gene_12960}} | + | |
− | {{#set: in pathway=PWY-6803|LIPASYN-PWY}}
| + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |
− | {{#set: reconstruction source=in-silico_annotation}}
| + | |