Difference between revisions of "Tiso gene 3109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCERATE-DEHYDROGENASE-RXN GLYCERATE-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec numb...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCERATE-DEHYDROGENASE-RXN GLYCERATE-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.1.1.29 EC-1.1.1.29] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OH-PYR]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[GLYCERATE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 hydroxypyruvate[c] '''=>''' 1 NAD+[c] '''+''' 1 D-glycerate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-181]], photorespiration: [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17905 17905] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01388 R01388] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P13443 P13443] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JWP1 Q9JWP1] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q42708 Q42708] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q42709 Q42709] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: ec number=EC-1.1.1.29}} |
− | + | {{#set: in pathway=PWY-181}} | |
− | {{#set: | + | {{#set: reconstruction category=manual}} |
− | {{#set: | + | {{#set: reconstruction source=manual-primary_network}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:49, 18 March 2018
Contents
Reaction GLYCERATE-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADH[c] + 1 H+[c] + 1 hydroxypyruvate[c] => 1 NAD+[c] + 1 D-glycerate[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual
- Source: manual-primary_network
External links