Difference between revisions of "METBALT-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19566 == * left end position: ** 57 * transcription direction: ** POSITIVE * right end position: ** 2180 * centisome position: ** 2.5664115...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L |
| − | * | + | * common name: |
| − | ** | + | ** triiodothyroacetate ether glucuronide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 796.046 |
* Synonym(s): | * Synonym(s): | ||
| + | ** triiodothyroacetic acid ether glucuronide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10619]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025] |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}} |
| − | {{#set: | + | {{#set: common name=triiodothyroacetate ether glucuronide}} |
| + | {{#set: molecular weight=796.046 }} | ||
| + | {{#set: common name=triiodothyroacetic acid ether glucuronide}} | ||
| + | {{#set: produced by=RXN-10619}} | ||
Revision as of 18:49, 18 March 2018
Contents
Metabolite CPD-11410
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
- inchi key:
- InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
- common name:
- triiodothyroacetate ether glucuronide
- molecular weight:
- 796.046
- Synonym(s):
- triiodothyroacetic acid ether glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))" cannot be used as a page name in this wiki.
