Difference between revisions of "INORGPYROPHOSPHAT-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14718 == * left end position: ** 3495 * transcription direction: ** POSITIVE * right end position: ** 5432 * centisome position: ** 63.9173...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == |
| − | * | + | * smiles: |
| − | ** | + | ** COC1(=CC(=CCCO)C=CC(=O)1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** coniferyl alcohol radical |
| − | * | + | * molecular weight: |
| − | ** | + | ** 179.195 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17352]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: common name=coniferyl alcohol radical}} |
| − | {{#set: | + | {{#set: molecular weight=179.195 }} |
| − | {{#set: | + | {{#set: produced by=RXN-17352}} |
| − | + | ||
Revision as of 18:49, 18 March 2018
Contents
Metabolite CPD-18761
- smiles:
- COC1(=CC(=CCCO)C=CC(=O)1)
- inchi key:
- InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
- common name:
- coniferyl alcohol radical
- molecular weight:
- 179.195
- Synonym(s):
