Difference between revisions of "RXN-18208"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15568 CPD-15568] == * smiles: ** CCCCCCCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15568 CPD-15568] == |
* smiles: | * smiles: | ||
| − | ** C(C( | + | ** CCCCCCCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MBCVYCOKMMMWLX-YYMFEJJQSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 2-trans-tetradecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 971.845 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (2E)-tetradecenoyl-CoA | ||
| + | ** trans-tetradec-2-enoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14131]] | ||
| + | * [[ACOA140or]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: smiles=C(C( | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05273 C05273] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61405 61405] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC61405 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173185 46173185] | ||
| + | * HMDB : HMDB03946 | ||
| + | {{#set: smiles=CCCCCCCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=MBCVYCOKMMMWLX-YYMFEJJQSA-J}} | ||
| + | {{#set: common name=2-trans-tetradecenoyl-CoA}} | ||
| + | {{#set: molecular weight=971.845 }} | ||
| + | {{#set: common name=(2E)-tetradecenoyl-CoA|trans-tetradec-2-enoyl-CoA}} | ||
| + | {{#set: produced by=RXN-14131|ACOA140or}} | ||
Revision as of 18:49, 18 March 2018
Contents
Metabolite CPD-15568
- smiles:
- CCCCCCCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=MBCVYCOKMMMWLX-YYMFEJJQSA-J
- common name:
- 2-trans-tetradecenoyl-CoA
- molecular weight:
- 971.845
- Synonym(s):
- (2E)-tetradecenoyl-CoA
- trans-tetradec-2-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
