Difference between revisions of "Tiso gene 1350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDDHm ALDDHm] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase (acetaldeh...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDDHm ALDDHm] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J
+
 
* common name:
 
* common name:
−
** feruloyl-CoA
+
** aldehyde dehydrogenase (acetaldehyde, NAD), mitochondrial
−
* molecular weight:
+
−
** 939.674   
+
 
* Synonym(s):
 
* Synonym(s):
−
** trans-feruloyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-1106]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ACETALD]][m] '''+''' 1.0 [[WATER]][m] '''+''' 1.0 [[NAD]][m] '''=>''' 1.0 [[NADH]][m] '''+''' 1.0 [[ACET]][m] '''+''' 2.0 [[PROTON]][m]
−
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* With common name(s):
−
* [[6.2.1.34-RXN]]
+
** 1.0 acetaldehyde[m] '''+''' 1.0 H2O[m] '''+''' 1.0 NAD+[m] '''=>''' 1.0 NADH[m] '''+''' 1.0 acetate[m] '''+''' 2.0 H+[m]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3513]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229137 44229137]
+
{{#set: common name=aldehyde dehydrogenase (acetaldehyde, NAD), mitochondrial}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3513}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57276 57276]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00406 C00406]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=GBXZVJQQDAJGSO-NBXNMEGSSA-J}}
+
−
{{#set: common name=feruloyl-CoA}}
+
−
{{#set: molecular weight=939.674    }}
+
−
{{#set: common name=trans-feruloyl-CoA}}
+
−
{{#set: consumed by=RXN-1106}}
+
−
{{#set: produced by=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN|6.2.1.34-RXN}}
+

Revision as of 18:50, 18 March 2018

Reaction ALDDHm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aldehyde dehydrogenase (acetaldehyde, NAD), mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[m] + 1.0 H2O[m] + 1.0 NAD+[m] => 1.0 NADH[m] + 1.0 acetate[m] + 2.0 H+[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1350&oldid=27186"