Difference between revisions of "RXN-9157"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4822 == * left end position: ** 12230 * transcription direction: ** POSITIVE * right end position: ** 15763 * centisome position: ** 68.642...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCCCCCCC(=O)C([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 8-(methylthio)-2-oxooctanoate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 203.276 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 8-(methylthio)-2-oxooctanoic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-18205]] | |
| − | + | * [[RXNQT-4171]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313] |
| − | {{#set: | + | * KNAPSACK : C00007643 |
| − | {{#set: | + | {{#set: smiles=CSCCCCCCC(=O)C([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=8-(methylthio)-2-oxooctanoate}} |
| + | {{#set: molecular weight=203.276 }} | ||
| + | {{#set: common name=8-(methylthio)-2-oxooctanoic acid}} | ||
| + | {{#set: produced by=RXN-18205|RXNQT-4171}} | ||
Revision as of 19:50, 18 March 2018
Contents
Metabolite CPDQT-29
- smiles:
- CSCCCCCCC(=O)C([O-])=O
- inchi key:
- InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
- common name:
- 8-(methylthio)-2-oxooctanoate
- molecular weight:
- 203.276
- Synonym(s):
- 8-(methylthio)-2-oxooctanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007643
"CSCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.
