Difference between revisions of "RXN-1126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-BETA-ASPARTYL-P L-BETA-ASPARTYL-P] == * smiles: ** C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-] *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-BETA-ASPARTYL-P L-BETA-ASPARTYL-P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IXZNKTPIYKDIGG-REOHCLBHSA-L |
* common name: | * common name: | ||
| − | ** | + | ** L-aspartyl-4-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 211.068 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-phospho-L-aspartate | ||
| + | ** L-4-aspartyl phosphate | ||
| + | ** L-β-aspartyl-P | ||
| + | ** L-β-aspartyl-phosphate | ||
| + | ** L-aspartyl-4-P | ||
| + | ** L-aspartyl-β-phosphate | ||
| + | ** 4-phosphonato-L-aspartate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
| + | * [[ASPARTATEKIN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 22138-53-0 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11948925 11948925] |
| − | {{#set: smiles= | + | * HMDB : HMDB12250 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03082 C03082] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10123241.html 10123241] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57535 57535] | ||
| + | * BIGG : 4pasp | ||
| + | {{#set: smiles=C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=IXZNKTPIYKDIGG-REOHCLBHSA-L}} | ||
| + | {{#set: common name=L-aspartyl-4-phosphate}} | ||
| + | {{#set: molecular weight=211.068 }} | ||
| + | {{#set: common name=4-phospho-L-aspartate|L-4-aspartyl phosphate|L-β-aspartyl-P|L-β-aspartyl-phosphate|L-aspartyl-4-P|L-aspartyl-β-phosphate|4-phosphonato-L-aspartate}} | ||
| + | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN|ASPARTATEKIN-RXN}} | ||
Revision as of 18:51, 18 March 2018
Contents
Metabolite L-BETA-ASPARTYL-P
- smiles:
- C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-]
- inchi key:
- InChIKey=IXZNKTPIYKDIGG-REOHCLBHSA-L
- common name:
- L-aspartyl-4-phosphate
- molecular weight:
- 211.068
- Synonym(s):
- 4-phospho-L-aspartate
- L-4-aspartyl phosphate
- L-β-aspartyl-P
- L-β-aspartyl-phosphate
- L-aspartyl-4-P
- L-aspartyl-β-phosphate
- 4-phosphonato-L-aspartate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 22138-53-0
- PUBCHEM:
- HMDB : HMDB12250
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 4pasp
"C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-" cannot be used as a page name in this wiki.
